
CAS 1260813-11-3
:3-(2,3,4-Trimethoxyphenyl)azetidine
Description:
3-(2,3,4-Trimethoxyphenyl)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 2,3,4-trimethoxyphenyl group indicates that the compound has three methoxy (-OCH3) substituents on a phenyl ring, contributing to its overall hydrophobicity and potential biological activity. The methoxy groups can enhance the compound's solubility in organic solvents and may influence its interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, the azetidine moiety can participate in various chemical reactions, potentially leading to the synthesis of derivatives with varied functionalities. Overall, 3-(2,3,4-trimethoxyphenyl)azetidine represents a unique structure that could be explored for its chemical reactivity and potential applications in drug development or other fields of chemistry.
Formula:C12H17NO3
InChI:InChI=1S/C12H17NO3/c1-14-10-5-4-9(8-6-13-7-8)11(15-2)12(10)16-3/h4-5,8,13H,6-7H2,1-3H3
InChI key:InChIKey=PPYXIUFFSBEAKU-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(OC)=C1OC)C2CNC2
Synonyms:- Azetidine, 3-(2,3,4-trimethoxyphenyl)-
- 3-(2,3,4-Trimethoxyphenyl)azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.