
CAS 1260813-98-6
:2-Chloro-4-(difluoromethoxy)benzonitrile
Description:
2-Chloro-4-(difluoromethoxy)benzonitrile is an organic compound characterized by its aromatic structure, featuring a chloro substituent and a difluoromethoxy group attached to a benzonitrile framework. This compound typically exhibits a white to off-white solid appearance and is known for its moderate solubility in organic solvents. The presence of the chloro and difluoromethoxy groups contributes to its unique electronic properties, potentially influencing its reactivity and interactions in chemical processes. As a nitrile, it contains a cyano group (-C≡N), which can participate in various chemical reactions, including nucleophilic additions. The compound may be utilized in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 2-Chloro-4-(difluoromethoxy)benzonitrile is a significant compound in organic synthesis and medicinal chemistry.
Formula:C8H4ClF2NO
InChI:InChI=1S/C8H4ClF2NO/c9-7-3-6(13-8(10)11)2-1-5(7)4-12/h1-3,8H
InChI key:InChIKey=WBXJFRYWZLASKL-UHFFFAOYSA-N
SMILES:C(#N)C1=C(Cl)C=C(OC(F)F)C=C1
Synonyms:- Benzonitrile, 2-chloro-4-(difluoromethoxy)-
- 2-Chloro-4-(difluoromethoxy)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.