
CAS 1260815-12-0
:2-(3-Pyrrolidinyl)-1H-pyrrole
Description:
2-(3-Pyrrolidinyl)-1H-pyrrole, identified by its CAS number 1260815-12-0, is a chemical compound characterized by its unique bicyclic structure, which includes a pyrrole ring and a pyrrolidine moiety. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as potential basicity due to the presence of nitrogen atoms. It may demonstrate solubility in polar organic solvents, reflecting the influence of its functional groups. The presence of both the pyrrole and pyrrolidine rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as these structures are often found in biologically active compounds. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the pyrrole ring, which can influence its reactivity and interaction with biological targets. Overall, 2-(3-Pyrrolidinyl)-1H-pyrrole represents a class of compounds that are of interest for further research in various chemical and biological applications.
Formula:C8H12N2
InChI:InChI=1S/C8H12N2/c1-2-8(10-4-1)7-3-5-9-6-7/h1-2,4,7,9-10H,3,5-6H2
InChI key:InChIKey=SAIJZPRPAHBVEJ-UHFFFAOYSA-N
SMILES:C1(CCNC1)C2=CC=CN2
Synonyms:- 2-(3-Pyrrolidinyl)-1H-pyrrole
- 1H-Pyrrole, 2-(3-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.