
CAS 1260815-88-0
:1-[4-Bromo-2-(difluoromethoxy)phenyl]ethanone
Description:
1-[4-Bromo-2-(difluoromethoxy)phenyl]ethanone, with the CAS number 1260815-88-0, is an organic compound characterized by its aromatic structure and the presence of a bromine atom and a difluoromethoxy group. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The bromine substituent enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The difluoromethoxy group introduces unique electronic properties, influencing the compound's polarity and solubility in different solvents. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. Additionally, the presence of halogens often affects the compound's stability and reactivity, which can be critical in designing derivatives for specific applications. Overall, 1-[4-Bromo-2-(difluoromethoxy)phenyl]ethanone is a versatile compound with potential implications in both synthetic chemistry and medicinal chemistry.
Formula:C9H7BrF2O2
InChI:InChI=1S/C9H7BrF2O2/c1-5(13)7-3-2-6(10)4-8(7)14-9(11)12/h2-4,9H,1H3
InChI key:InChIKey=KSSBXCQMHICOQQ-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(OC(F)F)C=C(Br)C=C1
Synonyms:- 1-[4-Bromo-2-(difluoromethoxy)phenyl]ethanone
- 1-[4-Bromo-2-(difluoromethoxy)phenyl]ethan-1-one
- Ethanone, 1-[4-bromo-2-(difluoromethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.