CAS 1260816-08-7

3-Chloro-4-fluorobenzeneethanimidamide

Description:

3-Chloro-4-fluorobenzeneethanimidamide is a chemical compound characterized by its specific functional groups and structural features. It contains a benzene ring substituted with both a chlorine atom and a fluorine atom, which contribute to its reactivity and potential applications in various chemical reactions. The ethanimidamide portion of the molecule indicates the presence of an amide functional group, which can influence its solubility and interaction with biological systems. This compound may exhibit properties such as moderate polarity due to the presence of halogen substituents and an amide group, which can affect its hydrogen bonding capabilities. Additionally, the presence of halogens often enhances the compound's stability and can influence its pharmacological properties, making it of interest in medicinal chemistry. The specific arrangement of atoms and the electronic effects of the substituents can also play a crucial role in determining the compound's reactivity and potential applications in synthesis or as a pharmaceutical agent. Overall, 3-Chloro-4-fluorobenzeneethanimidamide is a compound of interest in both organic chemistry and drug development.

Formula: C₈H₈ClFN₂

InChI: InChI=1S/C8H8ClFN2/c9-6-3-5(4-8(11)12)1-2-7(6)10/h1-3H,4H2,(H3,11,12)

InChI key: InChIKey=KNYKCZDYIOOUOH-UHFFFAOYSA-N

SMILES: C(C(=N)N)C1=CC(Cl)=C(F)C=C1

Synonyms:

• Benzeneethanimidamide, 3-chloro-4-fluoro-
• 3-Chloro-4-fluorobenzeneethanimidamide