CAS 1260817-78-4

Ethyl 2-methyl-β-oxo[1,1′-biphenyl]-4-propanoate

Description:

Ethyl 2-methyl-β-oxo[1,1′-biphenyl]-4-propanoate, identified by its CAS number 1260817-78-4, is an organic compound characterized by its complex structure, which includes a biphenyl moiety and an ester functional group. This compound typically exhibits a moderate to high degree of lipophilicity due to the presence of the biphenyl structure, which can influence its solubility in organic solvents. The β-oxo group contributes to its reactivity, making it a potential candidate for various chemical transformations, including condensation reactions and synthesis of more complex molecules. Ethyl esters generally have pleasant odors and can be used in flavoring and fragrance applications. Additionally, the presence of the methyl group can affect the compound's steric and electronic properties, potentially influencing its reactivity and interaction with biological systems. Overall, this compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. However, specific safety and handling guidelines should be followed due to the potential hazards associated with organic compounds.

Formula: C₁₈H₁₈O₃

InChI: InChI=1S/C18H18O3/c1-3-21-18(20)12-17(19)15-9-10-16(13(2)11-15)14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3

InChI key: InChIKey=UVBPFXNRMVSGPA-UHFFFAOYSA-N

SMILES: CC1=C(C=CC(C(CC(OCC)=O)=O)=C1)C2=CC=CC=C2

Synonyms:

• [1,1′-Biphenyl]-4-propanoic acid, 2-methyl-β-oxo-, ethyl ester
• Ethyl 2-methyl-β-oxo[1,1′-biphenyl]-4-propanoate