
CAS 1260822-03-4
:4-(2-Methyl-3-nitrophenyl)piperidine
Description:
4-(2-Methyl-3-nitrophenyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a 2-methyl-3-nitrophenyl substituent, indicating the presence of a nitro group (-NO2) and a methyl group (-CH3) on a phenyl ring, which is attached to the piperidine. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the piperidine and nitrophenyl moieties, which can influence biological activity. The compound may exhibit various physical and chemical properties, including solubility in organic solvents, stability under certain conditions, and specific reactivity patterns typical of nitro and amine functionalities. Additionally, the presence of the nitro group may impart unique electronic properties, affecting the compound's interaction with biological targets. As with any chemical substance, safety and handling precautions should be observed, particularly due to the potential toxicity associated with nitro compounds.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-9-11(10-5-7-13-8-6-10)3-2-4-12(9)14(15)16/h2-4,10,13H,5-8H2,1H3
InChI key:InChIKey=XMCFLBKDUPTKDK-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1N(=O)=O)C2CCNCC2
Synonyms:- 4-(2-Methyl-3-nitrophenyl)piperidine
- Piperidine, 4-(2-methyl-3-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.