CymitQuimica logo

CAS 1260827-01-7

:

2-Fluoro-4-iodo-N-methylbenzenamine

Description:
2-Fluoro-4-iodo-N-methylbenzenamine is an organic compound characterized by the presence of a fluorine atom and an iodine atom attached to a benzene ring, along with a methylamino group. This compound features a substituted aniline structure, where the amino group is modified with a methyl group, enhancing its solubility and reactivity. The presence of both halogens (fluorine and iodine) introduces unique electronic properties, influencing its reactivity in nucleophilic substitution reactions and potential applications in medicinal chemistry. The fluorine atom typically contributes to increased lipophilicity, while iodine can enhance the compound's ability to participate in various coupling reactions. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in drug development. Its molecular structure allows for potential interactions with biological targets, which can be explored in pharmacological studies. Overall, 2-Fluoro-4-iodo-N-methylbenzenamine is a versatile compound with significant implications in synthetic and medicinal chemistry.
Formula:C7H7FIN
InChI:InChI=1S/C7H7FIN/c1-10-7-3-2-5(9)4-6(7)8/h2-4,10H,1H3
InChI key:InChIKey=XAXVOXWTZJYYCD-UHFFFAOYSA-N
SMILES:N(C)C1=C(F)C=C(I)C=C1
Synonyms:
  • Benzenamine, 2-fluoro-4-iodo-N-methyl-
  • 2-Fluoro-4-iodo-N-methylaniline
  • 2-Fluoro-4-iodo-N-methylbenzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.