CymitQuimica logo

CAS 1260839-59-5

:

3-[4-(2-Methylpropyl)phenyl]pyrrolidine

Description:
3-[4-(2-Methylpropyl)phenyl]pyrrolidine, identified by its CAS number 1260839-59-5, is a chemical compound characterized by its unique molecular structure, which includes a pyrrolidine ring and a phenyl group substituted with a branched alkyl chain. This compound typically exhibits properties associated with both amines and aromatic compounds, such as moderate polarity and potential for hydrogen bonding due to the presence of the nitrogen atom in the pyrrolidine ring. The branched alkyl substituent can influence its solubility and reactivity, making it more lipophilic compared to similar compounds with linear chains. Additionally, the presence of the aromatic ring may contribute to its stability and potential interactions in biological systems. Such compounds are often studied for their pharmacological properties, as they may exhibit activity in various biological pathways. Overall, 3-[4-(2-Methylpropyl)phenyl]pyrrolidine represents a class of organic compounds with diverse applications in medicinal chemistry and material science.
Formula:C14H21N
InChI:InChI=1S/C14H21N/c1-11(2)9-12-3-5-13(6-4-12)14-7-8-15-10-14/h3-6,11,14-15H,7-10H2,1-2H3
InChI key:InChIKey=CAXAFAMYWXDZRF-UHFFFAOYSA-N
SMILES:C(C(C)C)C1=CC=C(C=C1)C2CCNC2
Synonyms:
  • Pyrrolidine, 3-[4-(2-methylpropyl)phenyl]-
  • 3-[4-(2-Methylpropyl)phenyl]pyrrolidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.