
CAS 1260843-96-6
:3-(3-Fluoro-5-methoxyphenyl)pyrrolidine
Description:
3-(3-Fluoro-5-methoxyphenyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a substituted phenyl group. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its chemical properties, potentially influencing its reactivity and biological activity. This compound may exhibit specific interactions due to the electron-withdrawing nature of the fluorine and the electron-donating characteristics of the methoxy group. Such substitutions can affect the compound's lipophilicity, solubility, and overall pharmacokinetic profile. It is important to note that compounds like this may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as they can interact with biological targets in unique ways. Additionally, the compound's stability, synthesis, and potential applications would depend on its specific molecular interactions and the conditions under which it is studied. As with any chemical substance, safety and handling precautions should be observed during its use in research or industrial applications.
Formula:C11H14FNO
InChI:InChI=1S/C11H14FNO/c1-14-11-5-9(4-10(12)6-11)8-2-3-13-7-8/h4-6,8,13H,2-3,7H2,1H3
InChI key:InChIKey=MDDISASBGSIWLM-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=C(F)C1)C2CCNC2
Synonyms:- Pyrrolidine, 3-(3-fluoro-5-methoxyphenyl)-
- 3-(3-Fluoro-5-methoxyphenyl)pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.