CAS 1260850-29-0
:5,6-Difluoro-1H-indole-2-carbonyl chloride
Description:
5,6-Difluoro-1H-indole-2-carbonyl chloride is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of two fluorine atoms at the 5 and 6 positions of the indole ring significantly influences its reactivity and physical properties, such as increased electronegativity and potential for hydrogen bonding. The carbonyl chloride functional group (–C(=O)Cl) at the 2-position enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate to high solubility in organic solvents. Its reactivity with nucleophiles, such as amines and alcohols, allows for the formation of diverse derivatives. As with many halogenated compounds, it may pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C9H4ClF2NO
InChI:InChI=1S/C9H4ClF2NO/c10-9(14)8-2-4-1-5(11)6(12)3-7(4)13-8/h1-3,13H
InChI key:InChIKey=KGRYFDCJXZRSNE-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=CC=2C(N1)=CC(F)=C(F)C2
Synonyms:- 5,6-Difluoro-1H-indole-2-carbonyl chloride
- 1H-Indole-2-carbonyl chloride, 5,6-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
