CAS 1260850-71-2

3-(5-Methyl-2-furanyl)piperidine

Description:

3-(5-Methyl-2-furanyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 5-methyl-2-furanyl group indicates that the compound has a furan ring substituted with a methyl group at the 5-position, which contributes to its unique chemical properties. This compound may exhibit interesting biological activities due to the combination of the piperidine and furan moieties, which are known to participate in various chemical reactions and interactions. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in organic synthesis and drug design. As with many organic compounds, its behavior in different environments, such as solvents or biological systems, would be essential for understanding its practical applications.

Formula: C₁₀H₁₅NO

InChI: InChI=1S/C10H15NO/c1-8-4-5-10(12-8)9-3-2-6-11-7-9/h4-5,9,11H,2-3,6-7H2,1H3

InChI key: InChIKey=DUZULTQLPNQKMW-UHFFFAOYSA-N

SMILES: CC=1OC(=CC1)C2CCCNC2

Synonyms:

• 3-(5-Methyl-2-furanyl)piperidine
• Piperidine, 3-(5-methyl-2-furanyl)-