CymitQuimica logo

CAS 1260851-71-5

:

3-Benzo[b]thien-3-ylazetidine

Description:
3-Benzo[b]thien-3-ylazetidine is a chemical compound characterized by its unique structure, which includes a benzo[b]thienyl group attached to an azetidine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the benzo[b]thienyl moiety suggests that it may possess interesting electronic properties and could participate in various chemical reactions, such as electrophilic substitutions. Azetidine, being a four-membered saturated ring, adds to the compound's strain and reactivity. The compound may also exhibit solubility in organic solvents, depending on its functional groups and overall polarity. Its potential applications could span medicinal chemistry, where it may serve as a scaffold for drug development, particularly in targeting specific biological pathways. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its utility and safety profile.
Formula:C11H11NS
InChI:InChI=1S/C11H11NS/c1-2-4-11-9(3-1)10(7-13-11)8-5-12-6-8/h1-4,7-8,12H,5-6H2
InChI key:InChIKey=ZXRHMHYJSVFFOF-UHFFFAOYSA-N
SMILES:C=1(C=2C(SC1)=CC=CC2)C3CNC3
Synonyms:
  • 3-Benzo[b]thien-3-ylazetidine
  • Azetidine, 3-benzo[b]thien-3-yl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.