CAS 1260854-78-1

4-Chloro-2-(3-piperidinyl)pyridine

Description:

4-Chloro-2-(3-piperidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 4-position with a chlorine atom and at the 2-position with a piperidine group. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the piperidine moiety may enhance its interaction with biological targets, such as receptors or enzymes. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular weight and specific functional groups suggest that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the chlorine atom can influence the compound's reactivity and lipophilicity, which are important factors in drug design and development. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₀H₁₃ClN₂

InChI: InChI=1S/C10H13ClN2/c11-9-3-5-13-10(6-9)8-2-1-4-12-7-8/h3,5-6,8,12H,1-2,4,7H2

InChI key: InChIKey=ZHZRHIHPKCPDHD-UHFFFAOYSA-N

SMILES: ClC=1C=C(N=CC1)C2CCCNC2

Synonyms:

• 4-Chloro-2-(3-piperidinyl)pyridine
• Pyridine, 4-chloro-2-(3-piperidinyl)-