
CAS 1260854-86-1
:3-(Trifluoromethyl)-4-pyridineethanamine
Description:
3-(Trifluoromethyl)-4-pyridineethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. This compound features an ethylamine side chain, which contributes to its basicity and potential interactions with biological targets. The trifluoromethyl group is known for its electron-withdrawing properties, which can stabilize certain reactive intermediates and influence the compound's overall polarity. As a result, 3-(Trifluoromethyl)-4-pyridineethanamine may exhibit unique pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and behavior in various chemical environments would depend on further studies, including its solubility, stability, and interaction with other molecules. Overall, this compound represents a class of fluorinated organic compounds that are increasingly relevant in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H9F3N2
InChI:InChI=1S/C8H9F3N2/c9-8(10,11)7-5-13-4-2-6(7)1-3-12/h2,4-5H,1,3,12H2
InChI key:InChIKey=XLXHGFPSPZUOEY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(CCN)=CC=NC1
Synonyms:- 4-Pyridineethanamine, 3-(trifluoromethyl)-
- 3-(Trifluoromethyl)-4-pyridineethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
