
CAS 1260859-37-7
:6-Ethyl-N-(phenylmethyl)-2-pyridinamine
Description:
6-Ethyl-N-(phenylmethyl)-2-pyridinamine, identified by its CAS number 1260859-37-7, is a chemical compound that belongs to the class of pyridinamines. This substance features a pyridine ring substituted at the 2-position with an amino group and at the 6-position with an ethyl group, along with a phenylmethyl group attached to the nitrogen atom. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of pyridine derivatives to interact with biological targets. The compound may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the amino group, which can participate in various chemical reactions, including acylation and alkylation. Additionally, the structural characteristics may influence its biological activity, making it a candidate for further investigation in drug discovery and development. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise characterization.
Formula:C14H16N2
InChI:InChI=1S/C14H16N2/c1-2-13-9-6-10-14(16-13)15-11-12-7-4-3-5-8-12/h3-10H,2,11H2,1H3,(H,15,16)
InChI key:InChIKey=ANSIDOXTPHWRRD-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)C=2N=C(CC)C=CC2
Synonyms:- 6-Ethyl-N-(phenylmethyl)-2-pyridinamine
- 2-Pyridinamine, 6-ethyl-N-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
