CAS 1260859-41-3

1,2,3,4-Tetrahydro-7-(1-piperazinyl)isoquinoline

Description:

1,2,3,4-Tetrahydro-7-(1-piperazinyl)isoquinoline is a chemical compound characterized by its bicyclic structure, which includes a tetrahydroisoquinoline core and a piperazine substituent. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating both nitrogen and carbon atoms. The presence of the piperazine moiety suggests potential pharmacological activity, as piperazine derivatives are often associated with various biological effects, including neuroactivity. The tetrahydroisoquinoline framework is known for its role in medicinal chemistry, particularly in the development of compounds with potential applications in treating neurological disorders. The compound is likely to be a solid at room temperature, with solubility characteristics that may vary depending on the solvent used. Its synthesis may involve multi-step organic reactions, and it may be of interest in research related to drug development, particularly in the context of central nervous system agents. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₃H₁₉N₃

InChI: InChI=1S/C13H19N3/c1-2-13(16-7-5-14-6-8-16)9-12-10-15-4-3-11(1)12/h1-2,9,14-15H,3-8,10H2

InChI key: InChIKey=LPCXVOVKNRPKKT-UHFFFAOYSA-N

SMILES: C=1(C=C2C(=CC1)CCNC2)N3CCNCC3

Synonyms:

• Isoquinoline, 1,2,3,4-tetrahydro-7-(1-piperazinyl)-
• 1,2,3,4-Tetrahydro-7-(1-piperazinyl)isoquinoline