CAS 1260862-07-4

3-(5-Chloro-2-nitrophenyl)pyrrolidine

Description:

3-(5-Chloro-2-nitrophenyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a 5-chloro-2-nitrophenyl group indicates that the compound has both chlorine and nitro substituents on the aromatic ring, contributing to its chemical reactivity and potential biological activity. The chlorine atom typically enhances lipophilicity, while the nitro group can influence the compound's electronic properties and reactivity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the presence of the pyrrolidine moiety may impart certain conformational flexibility, affecting its binding affinity and selectivity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with the halogen and nitro groups. Overall, 3-(5-Chloro-2-nitrophenyl)pyrrolidine represents a unique structure with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₁ClN₂O₂

InChI: InChI=1S/C10H11ClN2O2/c11-8-1-2-10(13(14)15)9(5-8)7-3-4-12-6-7/h1-2,5,7,12H,3-4,6H2

InChI key: InChIKey=TYCRXNXQLDZJHP-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=C(Cl)C=C1)C2CCNC2

Synonyms:

• 3-(5-Chloro-2-nitrophenyl)pyrrolidine
• Pyrrolidine, 3-(5-chloro-2-nitrophenyl)-