
CAS 1260863-05-5
:3-(3-Bromo-4-methoxyphenyl)pyrrolidine
Description:
3-(3-Bromo-4-methoxyphenyl)pyrrolidine is an organic compound characterized by its unique structural features, which include a pyrrolidine ring and a substituted phenyl group. The presence of a bromine atom and a methoxy group on the phenyl ring contributes to its chemical reactivity and potential biological activity. The bromine atom can enhance the compound's lipophilicity, while the methoxy group may influence its electronic properties and steric hindrance. This compound is likely to exhibit moderate solubility in organic solvents, and its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The pyrrolidine moiety is known for its role in various biological activities, making this compound of interest for further research. Additionally, the presence of halogen and ether functionalities may provide pathways for further chemical modifications, enhancing its utility in synthetic chemistry. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H14BrNO
InChI:InChI=1S/C11H14BrNO/c1-14-11-3-2-8(6-10(11)12)9-4-5-13-7-9/h2-3,6,9,13H,4-5,7H2,1H3
InChI key:InChIKey=BYBVXNIXYLCFPZ-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=CC1OC)C2CCNC2
Synonyms:- 3-(3-Bromo-4-methoxyphenyl)pyrrolidine
- Pyrrolidine, 3-(3-bromo-4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.