CAS 1260865-34-6

3-(2-Fluoro-4-nitrophenyl)pyrrolidine

Description:

3-(2-Fluoro-4-nitrophenyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of a 2-fluoro-4-nitrophenyl group indicates that the compound has both a fluorine atom and a nitro group attached to a phenyl ring, which can significantly influence its chemical reactivity and physical properties. The fluorine atom typically enhances lipophilicity and can affect the compound's interaction with biological targets, while the nitro group is known for its electron-withdrawing properties, which can impact the compound's acidity and reactivity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific applications would depend on its biological activity, which could be influenced by the structural features imparted by the substituents on the pyrrolidine and phenyl moieties. As with many organic compounds, its solubility, stability, and reactivity would be determined by the overall molecular structure and the functional groups present.

Formula: C₁₀H₁₁FN₂O₂

InChI: InChI=1S/C10H11FN2O2/c11-10-5-8(13(14)15)1-2-9(10)7-3-4-12-6-7/h1-2,5,7,12H,3-4,6H2

InChI key: InChIKey=XRGWDCRILCLZBQ-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(N(=O)=O)=C1)C2CCNC2

Synonyms:

• Pyrrolidine, 3-(2-fluoro-4-nitrophenyl)-
• 3-(2-Fluoro-4-nitrophenyl)pyrrolidine