CymitQuimica logo

CAS 1260869-41-7

:

4-(3-Azetidinyl)quinoline

Description:
4-(3-Azetidinyl)quinoline is a chemical compound characterized by its unique structure, which combines a quinoline moiety with an azetidine ring. Quinoline is a bicyclic aromatic compound known for its heterocyclic properties, while the azetidine ring introduces a four-membered nitrogen-containing structure. This compound may exhibit interesting pharmacological properties due to the presence of both the quinoline and azetidine functionalities, which are often associated with biological activity. The azetidine ring can influence the compound's interaction with biological targets, potentially enhancing its efficacy in medicinal chemistry applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present and the overall molecular geometry. As with many heterocyclic compounds, 4-(3-Azetidinyl)quinoline may be of interest in drug discovery and development, particularly in the search for new therapeutic agents. However, specific data regarding its biological activity, toxicity, and practical applications would require further investigation through experimental studies and literature review.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c1-2-4-12-11(3-1)10(5-6-14-12)9-7-13-8-9/h1-6,9,13H,7-8H2
InChI key:InChIKey=XZPIEKXATIAPJI-UHFFFAOYSA-N
SMILES:C=1(C2=C(N=CC1)C=CC=C2)C3CNC3
Synonyms:
  • 4-(3-Azetidinyl)quinoline
  • Quinoline, 4-(3-azetidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.