CymitQuimica logo

CAS 1260871-17-7

:

3-(2-Methyl-5-nitrophenyl)pyrrolidine

Description:
3-(2-Methyl-5-nitrophenyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a 2-methyl-5-nitrophenyl group indicates that the compound has a substituted aromatic system, contributing to its chemical reactivity and potential biological activity. The nitro group (-NO2) is known for its electron-withdrawing properties, which can influence the compound's reactivity and interactions with other molecules. This compound may exhibit properties typical of both amines and aromatic compounds, such as basicity and potential for electrophilic substitution. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyrrolidine and aromatic moieties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the specific substituents on the aromatic ring. Overall, 3-(2-Methyl-5-nitrophenyl)pyrrolidine is a compound of interest for further study in various chemical and biological contexts.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c1-8-2-3-10(13(14)15)6-11(8)9-4-5-12-7-9/h2-3,6,9,12H,4-5,7H2,1H3
InChI key:InChIKey=MBCGNLKVFSSEQL-UHFFFAOYSA-N
SMILES:CC=1C(=CC(N(=O)=O)=CC1)C2CCNC2
Synonyms:
  • Pyrrolidine, 3-(2-methyl-5-nitrophenyl)-
  • 3-(2-Methyl-5-nitrophenyl)pyrrolidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.