CAS 1260878-79-2
:2,5-Bis(trifluoromethyl)benzeneacetaldehyde
Description:
2,5-Bis(trifluoromethyl)benzeneacetaldehyde is an organic compound characterized by its unique structure, which features a benzene ring substituted with two trifluoromethyl groups and an aldehyde functional group. The presence of the trifluoromethyl groups significantly influences its chemical properties, imparting high electronegativity and lipophilicity, which can enhance its reactivity in various chemical reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as an electrophile in reactions. Additionally, the trifluoromethyl groups can enhance the compound's stability and resistance to oxidation. Safety considerations should be taken into account when handling this substance, as it may pose health risks and environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.
Formula:C10H6F6O
InChI:InChI=1S/C10H6F6O/c11-9(12,13)7-1-2-8(10(14,15)16)6(5-7)3-4-17/h1-2,4-5H,3H2
InChI key:InChIKey=VGZYUKBKRUURQG-UHFFFAOYSA-N
SMILES:C(C=O)C1=C(C(F)(F)F)C=CC(C(F)(F)F)=C1
Synonyms:- Benzeneacetaldehyde, 2,5-bis(trifluoromethyl)-
- 2,5-Bis(trifluoromethyl)benzeneacetaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
