
CAS 1260879-06-8
:2-Amino-4-methylenecyclobutanecarboxylic acid
Description:
2-Amino-4-methylenecyclobutanecarboxylic acid is an organic compound characterized by its unique cyclobutane ring structure, which is substituted with an amino group and a methylene group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the amino group indicates that it can participate in various chemical reactions, including those typical of amino acids, such as peptide bond formation. The methylene group adds to the complexity of its structure, potentially influencing its reactivity and interactions with other molecules. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and drug design. Additionally, its specific stereochemistry and functional groups can affect its solubility, stability, and overall behavior in different environments. As with many organic compounds, its properties can be influenced by factors such as pH, temperature, and the presence of other chemical species.
Formula:C6H9NO2
InChI:InChI=1S/C6H9NO2/c1-3-2-4(7)5(3)6(8)9/h4-5H,1-2,7H2,(H,8,9)
InChI key:InChIKey=SGMZRDANDOGMOK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(=C)CC1N
Synonyms:- 2-Amino-4-methylenecyclobutanecarboxylic acid
- Cyclobutanecarboxylic acid, 2-amino-4-methylene-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
