CymitQuimica logo

CAS 1260879-38-6

:

6-Chloro-2-pyrazinepropanenitrile

Description:
6-Chloro-2-pyrazinepropanenitrile is a chemical compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chloro substituent at the 6-position and a propanenitrile group at the 2-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the nitrile functional group, which can participate in various chemical reactions. Additionally, the chloro group can serve as a site for further substitution reactions. Safety data for this compound should be consulted, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Overall, 6-Chloro-2-pyrazinepropanenitrile is of interest in synthetic organic chemistry and may have implications in drug discovery and development.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c8-7-5-10-4-6(11-7)2-1-3-9/h4-5H,1-2H2
InChI key:InChIKey=PRRVPJDCHBTOJG-UHFFFAOYSA-N
SMILES:C(CC#N)C1=NC(Cl)=CN=C1
Synonyms:
  • 6-Chloro-2-pyrazinepropanenitrile
  • 2-Pyrazinepropanenitrile, 6-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.