CAS 126088-20-8

6-CHLORO-2-(4-CHLOROPHENYL)-4-QUINOLINE CARBOXYLIC ACID

Description:

6-Chloro-2-(4-chlorophenyl)-4-quinoline carboxylic acid is a chemical compound characterized by its quinoline structure, which features a bicyclic aromatic system. This compound contains a carboxylic acid functional group, contributing to its acidic properties. The presence of chlorine substituents at the 6 and 4 positions enhances its lipophilicity and may influence its biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while its solubility in water can vary depending on pH. It is often studied for its potential pharmaceutical applications, particularly in the development of antimicrobial or anti-inflammatory agents. The molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity or environmental impact.

Formula: C₁₆H₈Cl₂NO₂

InChI: InChI=1/C16H9Cl2NO2/c17-10-3-1-9(2-4-10)15-8-13(16(20)21)12-7-11(18)5-6-14(12)19-15/h1-8H,(H,20,21)/p-1

SMILES: c1cc(ccc1c1cc(c2cc(ccc2n1)Cl)C(=O)[O-])Cl

Synonyms:

• 4-Quinolinecarboxylic Acid, 6-Chloro-2-(4-Chlorophenyl)-
• 6-Chloro-2-(4-Chlorophenyl)Quinoline-4-Carboxylic Acid
• 6-Chloro-2-(4-Chlorophenyl)Quinoline-4-Carboxylate

4-Quinolinecarboxylic acid, 6-chloro-2-(4-chlorophenyl)-

CAS: 126088-20-8

Formula: C₁₆H₉Cl₂NO₂

Molecular weight: 318.1542

Ref: IN-DA000RIQ

6-Chloro-2-(4-chlorophenyl)quinoline-4-carboxylic acid

CAS: 126088-20-8

6-Chloro-2-(4-chlorophenyl)quinoline-4-carboxylic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 318.15g/mol

Ref: 54-OR14373