CAS 1260883-24-6

4-Aminopiperidin-2-one hydrochloride

Description:

4-Aminopiperidin-2-one hydrochloride is a chemical compound characterized by its piperidine structure, which includes an amine group and a carbonyl group. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, making it useful in pharmaceutical applications. The presence of the amino group contributes to its basicity, while the carbonyl group can participate in various chemical reactions, such as nucleophilic attacks. It is often utilized in the synthesis of various bioactive molecules and can serve as an intermediate in drug development. The hydrochloride salt form enhances its stability and solubility, which is advantageous for formulation in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, 4-Aminopiperidin-2-one hydrochloride is significant in the field of organic synthesis and medicinal chemistry due to its versatile reactivity and structural properties.

Formula: C₅H₁₁ClN₂O

InChI: InChI=1S/C5H10N2O.ClH/c6-4-1-2-7-5(8)3-4;/h4H,1-3,6H2,(H,7,8);1H

SMILES: C1CN=C(CC1N)O.Cl

Synonyms:

• 4-Aminopiperidin-2-one hydrochloride (1:1)

4-Amino-2-piperidinone, HCl

CAS: 1260883-24-6

Formula: C₅H₁₁ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 150.6066

Ref: IN-DA000RI2

4-Amino-2-piperidinone hydrochloride

CAS: 1260883-24-6

4-Amino-2-piperidinone hydrochloride

Formula: C₅H₁₀N₂O·ClH

Purity: 95%

Color and Shape: beige solid

Molecular weight: 150.61g/mol

Ref: 54-OR903524

4-Amino-2-piperidinone hydrochloride

CAS: 1260883-24-6

Formula: C₅H₁₁ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 150.61

Ref: 10-F076693