
CAS 1260885-47-9
:3-(2,3,4-Trimethoxyphenyl)pyrrolidine
Description:
3-(2,3,4-Trimethoxyphenyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of the 2,3,4-trimethoxyphenyl group indicates that the compound has three methoxy (-OCH3) substituents on a phenyl ring, which can influence its solubility, reactivity, and biological activity. The methoxy groups are electron-donating, which can enhance the compound's stability and affect its interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas related to neurochemistry or as a scaffold for synthesizing other bioactive molecules. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature references for precise values.
Formula:C13H19NO3
InChI:InChI=1S/C13H19NO3/c1-15-11-5-4-10(9-6-7-14-8-9)12(16-2)13(11)17-3/h4-5,9,14H,6-8H2,1-3H3
InChI key:InChIKey=DBNWPPWWKWBLPH-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(OC)=C1OC)C2CCNC2
Synonyms:- Pyrrolidine, 3-(2,3,4-trimethoxyphenyl)-
- 3-(2,3,4-Trimethoxyphenyl)pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.