
CAS 1260887-36-2
:4-(5-Bromo-2-methylphenyl)piperidine
Description:
4-(5-Bromo-2-methylphenyl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 5-bromo-2-methylphenyl group indicates that a bromine atom and a methyl group are substituted on the phenyl ring, influencing the compound's reactivity and physical properties. This compound is typically classified as an organic intermediate and may be of interest in medicinal chemistry due to its potential biological activity. Its molecular structure suggests it may exhibit lipophilic characteristics, which can affect its solubility and permeability in biological systems. The bromine substituent can also enhance the compound's reactivity in various chemical reactions, making it a useful building block in synthetic organic chemistry. Safety data and handling precautions should be considered, as halogenated compounds can pose specific health and environmental risks. Overall, 4-(5-Bromo-2-methylphenyl)piperidine is a compound of interest for further research and application in various chemical fields.
Formula:C12H16BrN
InChI:InChI=1S/C12H16BrN/c1-9-2-3-11(13)8-12(9)10-4-6-14-7-5-10/h2-3,8,10,14H,4-7H2,1H3
InChI key:InChIKey=ATFZUOTXLXBVHJ-UHFFFAOYSA-N
SMILES:CC1=C(C=C(Br)C=C1)C2CCNCC2
Synonyms:- Piperidine, 4-(5-bromo-2-methylphenyl)-
- 4-(5-Bromo-2-methylphenyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.