CAS 1260890-78-5

Ethyl 2-(trifluoromethyl)-3-quinolinecarboxylate

Description:

Ethyl 2-(trifluoromethyl)-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a trifluoromethyl group (-CF3) at the 2-position and an ethyl ester functional group at the 3-position of the quinoline ring. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Ethyl 2-(trifluoromethyl)-3-quinolinecarboxylate is typically a solid or liquid at room temperature, depending on its specific formulation and purity. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit unique reactivity and toxicity profiles. Overall, this compound exemplifies the intersection of aromatic chemistry and functional group manipulation, making it a valuable entity in various chemical applications.

Formula: C₁₃H₁₀F₃NO₂

InChI: InChI=1S/C13H10F3NO2/c1-2-19-12(18)9-7-8-5-3-4-6-10(8)17-11(9)13(14,15)16/h3-7H,2H2,1H3

InChI key: InChIKey=VPMQUMCPYKSGSU-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(C(F)(F)F)=NC2=C(C1)C=CC=C2

Synonyms:

• 3-Quinolinecarboxylic acid, 2-(trifluoromethyl)-, ethyl ester
• Ethyl 2-(trifluoromethyl)-3-quinolinecarboxylate