CAS 1260892-51-0
:1-(2-Chloroethyl)-2,3,4,5,6-pentafluorobenzene
Description:
1-(2-Chloroethyl)-2,3,4,5,6-pentafluorobenzene is a chemical compound characterized by its unique structure, which includes a pentafluorobenzene ring substituted with a chloroethyl group. This compound features a high degree of fluorination, which imparts significant chemical stability and alters its physical properties, such as increased hydrophobicity and volatility. The presence of the chloroethyl group introduces reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its fluorinated nature may also enhance its performance in applications such as solvents, intermediates in organic synthesis, or in the development of specialty materials. The compound is likely to be colorless to pale yellow and may have a distinct odor. Safety considerations are paramount, as the presence of chlorine and fluorine can pose health risks, necessitating proper handling and storage protocols. Overall, 1-(2-Chloroethyl)-2,3,4,5,6-pentafluorobenzene is a complex substance with applications in advanced chemical processes, though its environmental impact and toxicity should be carefully evaluated.
Formula:C8H4ClF5
InChI:InChI=1S/C8H4ClF5/c9-2-1-3-4(10)6(12)8(14)7(13)5(3)11/h1-2H2
InChI key:InChIKey=OUTJDNVITWIMKX-UHFFFAOYSA-N
SMILES:C(CCl)C1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:- 1-(2-Chloroethyl)-2,3,4,5,6-pentafluorobenzene
- Benzene, 1-(2-chloroethyl)-2,3,4,5,6-pentafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
