
CAS 1260897-96-8
:(2,2,6-Trimethylcyclohexyl)hydrazine
Description:
(2,2,6-Trimethylcyclohexyl)hydrazine is an organic compound characterized by its hydrazine functional group attached to a cyclohexane ring that has three methyl substituents. This structure contributes to its unique physical and chemical properties, including its potential as a hydrazine derivative. The presence of the bulky trimethyl groups can influence its reactivity, steric hindrance, and solubility in various solvents. Typically, hydrazines are known for their use in various applications, including as rocket propellants, in pharmaceuticals, and as intermediates in organic synthesis. The compound may exhibit moderate to high toxicity, necessitating careful handling and storage. Additionally, it may participate in redox reactions due to the presence of the hydrazine moiety, which can act as a reducing agent. Its specific applications and behavior in chemical reactions would depend on the context of its use and the conditions under which it is employed. As with all chemical substances, safety data sheets should be consulted for handling and exposure guidelines.
Formula:C9H20N2
InChI:InChI=1S/C9H20N2/c1-7-5-4-6-9(2,3)8(7)11-10/h7-8,11H,4-6,10H2,1-3H3
InChI key:InChIKey=VIIANFRUNPUDKC-UHFFFAOYSA-N
SMILES:N(N)C1C(C)(C)CCCC1C
Synonyms:- Hydrazine, (2,2,6-trimethylcyclohexyl)-
- (2,2,6-Trimethylcyclohexyl)hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.