CAS 1260898-74-5

[2-(3,5-Dimethylphenyl)ethyl]hydrazine

Description:

[2-(3,5-Dimethylphenyl)ethyl]hydrazine is an organic compound characterized by its hydrazine functional group, which consists of two nitrogen atoms connected by a single bond, and an ethyl group substituted with a 3,5-dimethylphenyl moiety. This compound typically exhibits properties associated with hydrazines, such as being a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is likely to be soluble in organic solvents due to its hydrophobic aromatic structure, while its hydrazine group may impart some degree of reactivity, particularly in redox reactions or as a potential ligand in coordination chemistry. The presence of the dimethylphenyl group can influence its physical properties, such as boiling point and melting point, as well as its biological activity, making it of interest in medicinal chemistry. Safety considerations are important, as hydrazines are known to be toxic and potentially carcinogenic, necessitating careful handling and storage.

Formula: C₁₀H₁₆N₂

InChI: InChI=1S/C10H16N2/c1-8-5-9(2)7-10(6-8)3-4-12-11/h5-7,12H,3-4,11H2,1-2H3

InChI key: InChIKey=NVFKUJFXTZFMCP-UHFFFAOYSA-N

SMILES: C(CNN)C1=CC(C)=CC(C)=C1

Synonyms:

• [2-(3,5-Dimethylphenyl)ethyl]hydrazine
• Hydrazine, [2-(3,5-dimethylphenyl)ethyl]-

Hydrazine, [2-(3,5-dimethylphenyl)ethyl]-

CAS: 1260898-74-5

Formula: C₁₀H₁₆N₂

Molecular weight: 164.2474

Ref: IN-DA000RK6