CAS 1260903-12-5

7-Bromo-5-chloro-1,2-benzoxazole

Description:

7-Bromo-5-chloro-1,2-benzoxazole is a heterocyclic organic compound characterized by its fused benzene and oxazole rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 7 and 5 positions, respectively, enhances its reactivity and potential applications in various chemical reactions. This compound typically exhibits moderate solubility in organic solvents, and its structure may influence its biological activity, making it of interest in medicinal chemistry and material science. The halogen substituents can also affect the compound's electronic properties, potentially leading to interesting photophysical behaviors. Additionally, 7-Bromo-5-chloro-1,2-benzoxazole may serve as a precursor or intermediate in the synthesis of more complex molecules, and its derivatives could be explored for their potential use in pharmaceuticals or agrochemicals. As with many halogenated compounds, considerations regarding environmental impact and safety are essential during handling and application.

Formula: C₇H₃BrClNO

InChI: InChI=1S/C7H3BrClNO/c8-6-2-5(9)1-4-3-10-11-7(4)6/h1-3H

SMILES: c1c2cnoc2c(cc1Cl)Br

Synonyms:

• 1,2-Benzisoxazole, 7-broMo-5-chloro-

1,2-BENZISOXAZOLE, 7-BROMO-5-CHLORO-

CAS: 1260903-12-5

Formula: C₇H₃BrClNO

Purity: 96%

Color and Shape: Solid

Molecular weight: 232.4618

Ref: IN-DA000RKZ

7-Bromo-5-chloro-1,2-benzoxazole

CAS: 1260903-12-5

7-Bromo-5-chloro-1,2-benzoxazole

Purity: 97%

Molecular weight: 232.46g/mol

Ref: 54-OR305029

7-Bromo-5-chlorobenzo[d]isoxazole

CAS: 1260903-12-5

Formula: C₇H₃BrClNO

Purity: 96%

Color and Shape: Solid

Molecular weight: 232.46

Ref: 10-F498027