CAS 1260903-20-5
:2-Amino-4,6-difluorobenzoic acid hydrazide
Description:
2-Amino-4,6-difluorobenzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group attached to a difluorobenzoic acid moiety. This compound features two fluorine atoms positioned at the 4 and 6 positions of the benzene ring, which can significantly influence its chemical reactivity and physical properties. The presence of the amino group enhances its potential for hydrogen bonding, making it soluble in polar solvents. The hydrazide functionality suggests potential applications in medicinal chemistry, particularly in the synthesis of biologically active compounds. The compound may exhibit interesting biological activities due to its structural features, which could be explored in drug development. Additionally, the fluorine substituents can enhance lipophilicity and metabolic stability, making it a candidate for further research in pharmaceutical applications. As with many hydrazides, it may also participate in various chemical reactions, including condensation and coupling reactions, which are valuable in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H7F2N3O
InChI:InChI=1S/C7H7F2N3O/c8-3-1-4(9)6(5(10)2-3)7(13)12-11/h1-2H,10-11H2,(H,12,13)
InChI key:InChIKey=MSYFUYXOSPRSKG-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=C(F)C=C(F)C=C1N
Synonyms:- Benzoic acid, 2-amino-4,6-difluoro-, hydrazide
- 2-Amino-4,6-difluorobenzoic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
