CAS 1260903-21-6

2-Amino-4-iodobenzenemethanol

Description:

2-Amino-4-iodobenzenemethanol, with the CAS number 1260903-21-6, is an organic compound characterized by the presence of an amino group (-NH2), an iodine atom, and a hydroxymethyl group (-CH2OH) attached to a benzene ring. This compound features a benzene core substituted at the para position with an iodine atom and at the meta position with an amino group, along with a hydroxymethyl group. The presence of the amino group imparts basic properties, while the hydroxymethyl group contributes to its potential as a reactive site in further chemical reactions. The iodine substituent can enhance the compound's reactivity in nucleophilic substitution reactions. Additionally, the compound may exhibit polar characteristics due to the hydroxymethyl and amino groups, influencing its solubility in various solvents. Its unique structure makes it of interest in organic synthesis and medicinal chemistry, where it may serve as a precursor or intermediate in the development of pharmaceuticals or other functional materials.

Formula: C₇H₈INO

InChI: InChI=1S/C7H8INO/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4,9H2

InChI key: InChIKey=WRPDTVXVPSNORZ-UHFFFAOYSA-N

SMILES: C(O)C1=C(N)C=C(I)C=C1

Synonyms:

• Benzenemethanol, 2-amino-4-iodo-
• (2-Amino-4-iodophenyl)methanol
• 2-Amino-4-iodobenzenemethanol

(2-Amino-4-iodophenyl)methanol

CAS: 1260903-21-6

Formula: C₇H₈INO

Molecular weight: 249.0490

Ref: IN-DA000RKV