CAS 1260903-27-2
:4-Chloro-1H-indazole-3-carbonyl chloride
Description:
4-Chloro-1H-indazole-3-carbonyl chloride is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a chloro substituent at the 4-position and a carbonyl chloride functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate to high solubility in organic solvents such as dichloromethane or acetone, while being less soluble in water due to its hydrophobic indazole structure. The carbonyl chloride group makes it a useful intermediate for acylation reactions, allowing for the introduction of various functional groups. Additionally, the chloro substituent can participate in nucleophilic substitution reactions, further expanding its utility in synthetic chemistry. Safety precautions should be taken when handling this compound, as it may be corrosive and harmful upon exposure. Overall, 4-Chloro-1H-indazole-3-carbonyl chloride is a versatile building block in the development of pharmaceuticals and agrochemicals.
Formula:C8H4Cl2N2O
InChI:InChI=1S/C8H4Cl2N2O/c9-4-2-1-3-5-6(4)7(8(10)13)12-11-5/h1-3H,(H,11,12)
InChI key:InChIKey=UVLFJFGNWDDXLA-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C=2C(NN1)=CC=CC2Cl
Synonyms:- 4-Chloro-1H-indazole-3-carbonyl chloride
- 1H-Indazole-3-carbonyl chloride, 4-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
