CAS 1260913-58-3
:4-Bromo-6-(3-methoxyphenyl)pyrimidine
Description:
4-Bromo-6-(3-methoxyphenyl)pyrimidine is an organic compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 4-position and a 3-methoxyphenyl group at the 6-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. It is often utilized in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The methoxy group can enhance the compound's lipophilicity, influencing its interaction with biological targets. Additionally, the bromine substituent can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic organic chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C11H9BrN2O
InChI:InChI=1S/C11H9BrN2O/c1-15-9-4-2-3-8(5-9)10-6-11(12)14-7-13-10/h2-7H,1H3
InChI key:InChIKey=QTDDBVOMVRMXDS-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1)C=2C=C(Br)N=CN2
Synonyms:- Pyrimidine, 4-bromo-6-(3-methoxyphenyl)-
- 4-Bromo-6-(3-methoxyphenyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.