CAS 1261-86-5

4,4′,4′′,4′′′-(1,2-Ethenediylidene)tetrakis[N,N-dimethylbenzenamine]

Description:

4,4′,4′′,4′′′-(1,2-Ethenediylidene)tetrakis[N,N-dimethylbenzenamine], commonly referred to as a type of tetramine, is a chemical compound characterized by its complex structure featuring multiple amine groups. This substance is known for its vibrant color and is often utilized in dye chemistry and as a precursor in various organic synthesis reactions. The presence of the ethenediylidene moiety contributes to its reactivity, allowing it to participate in polymerization and cross-linking processes. Its N,N-dimethylbenzenamine groups enhance solubility in organic solvents, making it suitable for applications in coatings and inks. Additionally, the compound exhibits interesting electronic properties due to the conjugated system formed by the ethenediylidene linkage, which can influence its optical characteristics. Safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested, necessitating appropriate protective measures in laboratory settings. Overall, its unique structural features and reactivity make it a valuable compound in various chemical applications.

Formula: C₃₄H₄₀N₄

InChI: InChI=1S/C34H40N4/c1-35(2)29-17-9-25(10-18-29)33(26-11-19-30(20-12-26)36(3)4)34(27-13-21-31(22-14-27)37(5)6)28-15-23-32(24-16-28)38(7)8/h9-24H,1-8H3

InChI key: InChIKey=PJZWENDBSVLVEB-UHFFFAOYSA-N

SMILES: C(=C(C1=CC=C(N(C)C)C=C1)C2=CC=C(N(C)C)C=C2)(C3=CC=C(N(C)C)C=C3)C4=CC=C(N(C)C)C=C4

Synonyms:

• 4,4′,4′′,4′′′-(1,2-Ethenediylidene)tetrakis[N,N-dimethylbenzenamine]
• Aniline, 4,4′,4′′,4′′′-ethenediylidenetetrakis[N,N-dimethyl-
• Benzenamine, 4,4′,4′′,4′′′-(1,2-ethenediylidene)tetrakis[N,N-dimethyl-
• Tetrakis[p-(dimethylamino)phenyl]ethylene
• Tetrakis[4-(dimethylamino)phenyl]ethene