CAS 1261079-60-0

1-(4-Aminophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid

Description:

1-(4-Aminophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) attached to a phenyl group, contributing to its potential biological activity. The presence of a carboxylic acid group (-COOH) indicates that it can act as an acid, participating in various chemical reactions, including esterification and amidation. The methyl group (-CH3) at the 5-position of the pyrazole ring influences its solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially leading to therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a subject of study in various chemical and pharmaceutical research contexts.

Formula: C₁₁H₁₁N₃O₂

InChI: InChI=1S/C11H11N3O2/c1-7-6-10(11(15)16)13-14(7)9-4-2-8(12)3-5-9/h2-6H,12H2,1H3,(H,15,16)

InChI key: InChIKey=RWDKEGLJGZTOJR-UHFFFAOYSA-N

SMILES: CC=1N(N=C(C(O)=O)C1)C2=CC=C(N)C=C2

Synonyms:

• 1-(4-Aminophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 1-(4-aminophenyl)-5-methyl-