CAS 1261079-62-2

Methyl 3-hydroxy-4-methoxy-2,6-dinitrobenzoate

Description:

Methyl 3-hydroxy-4-methoxy-2,6-dinitrobenzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety substituted with hydroxyl, methoxy, and dinitro groups. This compound typically exhibits a yellow to orange color due to the presence of the dinitro groups, which are known to impart strong electron-withdrawing properties. The hydroxyl group contributes to its potential solubility in polar solvents, while the methoxy group can influence its reactivity and interaction with other chemical species. The presence of multiple nitro groups suggests that this compound may exhibit significant reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, the compound may possess biological activity, making it of interest in fields such as medicinal chemistry or agrochemicals. Safety considerations are important, as nitro compounds can be hazardous, and appropriate handling and disposal methods should be employed. Overall, Methyl 3-hydroxy-4-methoxy-2,6-dinitrobenzoate is a notable compound with diverse chemical properties and potential applications.

Formula: C₉H₈N₂O₈

InChI: InChI=1S/C9H8N2O8/c1-18-5-3-4(10(14)15)6(9(13)19-2)7(8(5)12)11(16)17/h3,12H,1-2H3

InChI key: InChIKey=WVGAHQOINHARSS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(N(=O)=O)C(O)=C(OC)C=C1N(=O)=O

Synonyms:

• Methyl 3-hydroxy-4-methoxy-2,6-dinitrobenzoate
• Benzoic acid, 3-hydroxy-4-methoxy-2,6-dinitro-, methyl ester