
CAS 1261079-64-4
:1H-Benzimidazol-2-amine, 1-methyl-5-nitro-, hydrobromide (1:1)
Description:
1H-Benzimidazol-2-amine, 1-methyl-5-nitro-, hydrobromide (1:1) is a chemical compound characterized by its benzimidazole core, which features a nitrogen-containing heterocyclic structure. The presence of a methyl group at the 1-position and a nitro group at the 5-position contributes to its unique reactivity and potential biological activity. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit properties such as antimicrobial or anticancer activity, owing to the structural features common in benzimidazole derivatives. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many nitro compounds, due to potential toxicity and environmental concerns. Overall, this compound represents a significant class of heterocyclic compounds with diverse applications in science and industry.
Formula:C8H8N4O2·BrH
InChI:InChI=1S/C8H8N4O2.BrH/c1-11-7-3-2-5(12(13)14)4-6(7)10-8(11)9;/h2-4H,1H3,(H2,9,10);1H
InChI key:InChIKey=UXDJNLUVQVMUEC-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(N(=O)=O)=CC2)N=C1N.Br
Synonyms:- 1H-Benzimidazol-2-amine, 1-methyl-5-nitro-, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.