CymitQuimica logo

CAS 1261079-66-6

:

Piperazine, 1-(4-fluoro-5-methyl-2-nitrophenyl)-, hydrochloride (1:1)

Description:
Piperazine, 1-(4-fluoro-5-methyl-2-nitrophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This substance features a 4-fluoro-5-methyl-2-nitrophenyl substituent, contributing to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the nitro group suggests potential reactivity and interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit specific pharmacological effects, possibly related to its interactions with neurotransmitter systems or other biological pathways. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific class of piperazine derivatives that may have applications in drug development or research.
Formula:C11H14FN3O2·ClH
InChI:InChI=1S/C11H14FN3O2.ClH/c1-8-6-10(14-4-2-13-3-5-14)11(15(16)17)7-9(8)12;/h6-7,13H,2-5H2,1H3;1H
InChI key:InChIKey=DSHAPVZARCLESC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=C(C)C(F)=C1)N2CCNCC2.Cl
Synonyms:
  • Piperazine, 1-(4-fluoro-5-methyl-2-nitrophenyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.