
CAS 1261079-67-7
:1-Oxa-8-azaspiro[4.5]decane, 3-(phenylmethyl)-, hydrochloride (1:1)
Description:
1-Oxa-8-azaspiro[4.5]decane, 3-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which includes both an oxygen and a nitrogen atom within its ring system. This compound features a phenylmethyl group, contributing to its potential biological activity and interactions. The hydrochloride salt form indicates that it is a hydrochloride, which typically enhances solubility in water and may influence its pharmacokinetic properties. The presence of the spirocyclic framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound's molecular structure may exhibit specific stereochemistry, which can significantly affect its biological activity and receptor interactions. As with many compounds in medicinal chemistry, understanding its characteristics, including solubility, stability, and reactivity, is crucial for its application in drug development and therapeutic use. Further studies would be necessary to elucidate its full pharmacological profile and potential therapeutic applications.
Formula:C15H21NO·ClH
InChI:InChI=1S/C15H21NO.ClH/c1-2-4-13(5-3-1)10-14-11-15(17-12-14)6-8-16-9-7-15;/h1-5,14,16H,6-12H2;1H
InChI key:InChIKey=QCYCTVCNBHHPKW-UHFFFAOYSA-N
SMILES:C(C1CC2(OC1)CCNCC2)C3=CC=CC=C3.Cl
Synonyms:- 1-Oxa-8-azaspiro[4.5]decane, 3-(phenylmethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.