CymitQuimica logo

CAS 1261079-69-9

:

5,8-Dichloro-1,2,3,4-tetrahydro-7-nitroisoquinoline

Description:
5,8-Dichloro-1,2,3,4-tetrahydro-7-nitroisoquinoline is a chemical compound characterized by its unique bicyclic structure, which includes a tetrahydroisoquinoline framework. The presence of two chlorine atoms at the 5 and 8 positions, along with a nitro group at the 7 position, contributes to its distinct chemical properties and reactivity. This compound is typically classified as a heterocyclic organic compound, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The dichloro and nitro substituents can influence the compound's biological activity, solubility, and interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics, such as UV-Vis and NMR spectra, which can be utilized for its identification and characterization in laboratory settings. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, making it of interest for synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of halogen and nitro groups, which can pose health risks.
Formula:C9H8Cl2N2O2
InChI:InChI=1S/C9H8Cl2N2O2/c10-7-3-8(13(14)15)9(11)6-4-12-2-1-5(6)7/h3,12H,1-2,4H2
InChI key:InChIKey=QPTPFMNJFRVNGB-UHFFFAOYSA-N
SMILES:ClC1=C2C(=C(Cl)C=C1N(=O)=O)CCNC2
Synonyms:
  • Isoquinoline, 5,8-dichloro-1,2,3,4-tetrahydro-7-nitro-
  • 5,8-Dichloro-1,2,3,4-tetrahydro-7-nitroisoquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.