CAS 1261079-69-9

5,8-Dichloro-1,2,3,4-tetrahydro-7-nitroisoquinoline

Description:

5,8-Dichloro-1,2,3,4-tetrahydro-7-nitroisoquinoline is a chemical compound characterized by its unique bicyclic structure, which includes a tetrahydroisoquinoline framework. The presence of two chlorine atoms at the 5 and 8 positions, along with a nitro group at the 7 position, contributes to its distinct chemical properties and reactivity. This compound is typically classified as a heterocyclic organic compound, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The dichloro and nitro substituents can influence the compound's biological activity, solubility, and interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics, such as UV-Vis and NMR spectra, which can be utilized for its identification and characterization in laboratory settings. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, making it of interest for synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of halogen and nitro groups, which can pose health risks.

Formula: C₉H₈Cl₂N₂O₂

InChI: InChI=1S/C9H8Cl2N2O2/c10-7-3-8(13(14)15)9(11)6-4-12-2-1-5(6)7/h3,12H,1-2,4H2

InChI key: InChIKey=QPTPFMNJFRVNGB-UHFFFAOYSA-N

SMILES: ClC1=C2C(=C(Cl)C=C1N(=O)=O)CCNC2

Synonyms:

• Isoquinoline, 5,8-dichloro-1,2,3,4-tetrahydro-7-nitro-
• 5,8-Dichloro-1,2,3,4-tetrahydro-7-nitroisoquinoline