CymitQuimica logo

CAS 1261079-70-2

:

1,1-Dimethylethyl 4-(4-fluoro-5-methyl-2-nitrophenyl)-1-piperazinecarboxylate

Description:
1,1-Dimethylethyl 4-(4-fluoro-5-methyl-2-nitrophenyl)-1-piperazinecarboxylate, identified by its CAS number 1261079-70-2, is a chemical compound characterized by its complex structure, which includes a piperazine ring and various functional groups. This substance typically exhibits properties associated with both piperazine derivatives and nitrophenyl compounds, such as potential biological activity and solubility in organic solvents. The presence of the fluoro and nitro substituents suggests that it may have specific interactions in biological systems, potentially influencing its pharmacological profile. Additionally, the dimethyl group contributes to steric hindrance, which can affect the compound's reactivity and binding affinity to biological targets. As with many synthetic organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents. Safety data and handling precautions should be considered due to the presence of nitro groups, which can be associated with toxicity and environmental concerns.
Formula:C16H22FN3O4
InChI:InChI=1S/C16H22FN3O4/c1-11-9-13(14(20(22)23)10-12(11)17)18-5-7-19(8-6-18)15(21)24-16(2,3)4/h9-10H,5-8H2,1-4H3
InChI key:InChIKey=MSBSESRLZPZBEQ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=C(C)C(F)=C1)N2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1-Piperazinecarboxylic acid, 4-(4-fluoro-5-methyl-2-nitrophenyl)-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 4-(4-fluoro-5-methyl-2-nitrophenyl)-1-piperazinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.