CAS 1261079-73-5

Benzoic acid, 3-methoxy-4-(4-piperidinylmethoxy)-, methyl ester, hydrochloride (1:1)

Description:

Benzoic acid, 3-methoxy-4-(4-piperidinylmethoxy)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety, methoxy groups, and a piperidine ring. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The piperidine group contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of methoxy groups can influence its lipophilicity and reactivity, affecting its interaction with biological targets. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit various pharmacological properties, including analgesic or anti-inflammatory effects, but specific biological activities would require further investigation. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₅H₂₁NO₄·ClH

InChI: InChI=1S/C15H21NO4.ClH/c1-18-14-9-12(15(17)19-2)3-4-13(14)20-10-11-5-7-16-8-6-11;/h3-4,9,11,16H,5-8,10H2,1-2H3;1H

InChI key: InChIKey=LTCRCAZFDRHEJS-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=C(OC)C=C(C(OC)=O)C=C2.Cl

Synonyms:

• Benzoic acid, 3-methoxy-4-(4-piperidinylmethoxy)-, methyl ester, hydrochloride (1:1)