
CAS 1261079-75-7
:Methyl 1,2-dihydro-2-oxo-1′-(phenylmethyl)spiro[3H-indole-3,2′-pyrrolidine]-4′-carboxylate
Description:
Methyl 1,2-dihydro-2-oxo-1′-(phenylmethyl)spiro[3H-indole-3,2′-pyrrolidine]-4′-carboxylate, with the CAS number 1261079-75-7, is a complex organic compound characterized by its spirocyclic structure, which incorporates both indole and pyrrolidine moieties. This compound features a methyl ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the phenylmethyl group enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. The dihydro-2-oxo group indicates that it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Its unique structural features suggest potential applications in medicinal chemistry, particularly in the development of novel pharmaceuticals. However, specific biological activities, toxicity, and environmental impact would require further investigation through experimental studies. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential therapeutic applications.
Formula:C20H20N2O3
InChI:InChI=1S/C20H20N2O3/c1-25-18(23)15-11-20(16-9-5-6-10-17(16)21-19(20)24)22(13-15)12-14-7-3-2-4-8-14/h2-10,15H,11-13H2,1H3,(H,21,24)
InChI key:InChIKey=LTHUKCPBBFCJFO-UHFFFAOYSA-N
SMILES:C(N1C2(C=3C(NC2=O)=CC=CC3)CC(C(OC)=O)C1)C4=CC=CC=C4
Synonyms:- Methyl 1,2-dihydro-2-oxo-1′-(phenylmethyl)spiro[3H-indole-3,2′-pyrrolidine]-4′-carboxylate
- Spiro[3H-indole-3,2′-pyrrolidine]-4′-carboxylic acid, 1,2-dihydro-2-oxo-1′-(phenylmethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.