CAS 1261079-76-8

Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-iodo-, ethyl ester, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-iodo-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine core structure, which is known for its diverse biological activities. The presence of the carboxylic acid and ethyl ester functional groups suggests potential for reactivity and solubility in various solvents. The 6-iodo substitution introduces a halogen, which can influence the compound's electronic properties and reactivity, potentially enhancing its pharmacological profile. As a hydrochloride salt, it is likely to exhibit improved stability and solubility in aqueous environments, making it suitable for pharmaceutical applications. This compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents, due to the biological significance of imidazo-pyridine derivatives. Its specific interactions and effects would depend on further studies, including biological assays and structure-activity relationship evaluations. Overall, this compound represents a unique combination of structural features that may contribute to its potential utility in drug discovery and development.

Formula: C₁₀H₉IN₂O₂·ClH

InChI: InChI=1S/C10H9IN2O2.ClH/c1-2-15-10(14)8-6-13-5-7(11)3-4-9(13)12-8;/h3-6H,2H2,1H3;1H

InChI key: InChIKey=LOBXZDCMPCJLOQ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CN2C(=N1)C=CC(I)=C2.Cl

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-iodo-, ethyl ester, hydrochloride (1:1)