CymitQuimica logo

CAS 12611-51-7

:

Neodymate(1-), [[N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, hydrogen (1:1), (OC-6-21)-

Description:
Neodymate(1-), with the CAS number 12611-51-7, is a coordination compound that features neodymium as its central metal ion, coordinated by a complex ligand derived from N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]. This compound typically exhibits characteristics common to lanthanide complexes, such as high stability and solubility in polar solvents. The presence of carboxylate groups in the ligand contributes to its chelating ability, allowing for strong interactions with the neodymium ion. Neodymate(1-) may display unique optical and magnetic properties due to the f-electron configuration of neodymium, making it of interest in various applications, including materials science and biochemistry. Additionally, the compound's structure suggests potential for forming hydrogen bonds, which can influence its solubility and reactivity. Overall, neodymate(1-) is a complex that exemplifies the intricate chemistry of lanthanide coordination compounds, with potential implications in both research and industrial applications.
Formula:C10H12N2NdO8·H
InChI:InChI=1S/C10H16N2O8.Nd/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);/q;+3/p-3
InChI key:InChIKey=QGSNBBYVXDXAOD-UHFFFAOYSA-K
SMILES:O=C1[O-][Nd+3]2345[N](CC(=O)[O-]2)(CC(=O)[O-]3)CC[N]4(CC(=O)[O-]5)C1.[H+]
Synonyms:
  • Neodymate(1-), [[N,N′-1,2-ethanediylbis[N-(carboxymethyl)glycinato]](4-)-N,N′,O,O′,ON,ON′]-, hydrogen, (OC-6-21)-
  • Hydrogen [(ethylenedinitrilo)tetraacetato]neodymate(III)
  • Neodymate(1-), [[N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, hydrogen (1:1), (OC-6-21)-
  • Neodymate(1-), [[N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, hydrogen, (OC-6-21)-
  • Neodymium ethylenediaminetetraacetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.